C19H23N2O8P — CID 156835242
3-methoxypropyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 156835242) has the molecular formula C19H23N2O8P and a molecular weight of 438.37 g/mol. Its IUPAC name is 3-methoxypropyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3-methoxypropyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156835242 |
| Molecular Formula | C19H23N2O8P |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-methoxypropyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | COCCCOC(=O)[C@H](C)NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23N2O8P/c1-15(19(22)27-14-6-13-26-2)20-30(25,28-17-7-4-3-5-8-17)29-18-11-9-16(10-12-18)21(23)24/h3-5,7-12,15H,6,13-14H2,1-2H3,(H,20,25)/t15-,30?/m0/s1 |
| InChIKey | VQBHZQWCGULPGK-ZGTMUKSFSA-N |
| XLogP | 3.72 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|