C21H27N2O7P — CID 86711792
3,3-dimethylbutyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate (PubChem CID 86711792) has the molecular formula C21H27N2O7P and a molecular weight of 450.43 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate.
| Compound Name | 3,3-dimethylbutyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 86711792 |
| Molecular Formula | C21H27N2O7P |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)OCCC(C)(C)C |
| InChI | InChI=1S/C21H27N2O7P/c1-16(20(24)28-15-14-21(2,3)4)22-31(27,29-18-8-6-5-7-9-18)30-19-12-10-17(11-13-19)23(25)26/h5-13,16H,14-15H2,1-4H3,(H,22,27)/t16-,31?/m0/s1 |
| InChIKey | LCNXEEDEXJBKSQ-YDIHDLSKSA-N |
| XLogP | 5.12 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|