C19H23N2O7P — CID 121304000
2,4-dimethyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]pentanoic acid (PubChem CID 121304000) has the molecular formula C19H23N2O7P and a molecular weight of 422.37 g/mol. Its IUPAC name is 2,4-dimethyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]pentanoic acid.
| Compound Name | 2,4-dimethyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]pentanoic acid |
|---|---|
| PubChem CID | 121304000 |
| Molecular Formula | C19H23N2O7P |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2,4-dimethyl-2-[[(4-nitrophenoxy)-phenoxyphosphoryl]amino]pentanoic acid |
| SMILES | CC(C)CC(C)(NP(=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1)C(=O)O |
| InChI | InChI=1S/C19H23N2O7P/c1-14(2)13-19(3,18(22)23)20-29(26,27-16-7-5-4-6-8-16)28-17-11-9-15(10-12-17)21(24)25/h4-12,14H,13H2,1-3H3,(H,20,26)(H,22,23) |
| InChIKey | YRMBYRCLEBFHKP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|