C19H22NO7P — CID 123227091
propan-2-yl (2R)-2-methyl-3-[(4-nitrophenoxy)-phenoxyphosphoryl]propanoate (PubChem CID 123227091) has the molecular formula C19H22NO7P and a molecular weight of 407.36 g/mol. Its IUPAC name is propan-2-yl (2R)-2-methyl-3-[(4-nitrophenoxy)-phenoxyphosphoryl]propanoate.
| Compound Name | propan-2-yl (2R)-2-methyl-3-[(4-nitrophenoxy)-phenoxyphosphoryl]propanoate |
|---|---|
| PubChem CID | 123227091 |
| Molecular Formula | C19H22NO7P |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | propan-2-yl (2R)-2-methyl-3-[(4-nitrophenoxy)-phenoxyphosphoryl]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)C[P@@](=O)(Oc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22NO7P/c1-14(2)25-19(21)15(3)13-28(24,26-17-7-5-4-6-8-17)27-18-11-9-16(10-12-18)20(22)23/h4-12,14-15H,13H2,1-3H3/t15-,28+/m0/s1 |
| InChIKey | KGQAHTJFDFFVSD-OHZJNBGDSA-N |
| XLogP | 4.83 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|