C14H21N2O7P — CID 156635379
propan-2-yl (2S)-2-[[methoxymethyl-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 156635379) has the molecular formula C14H21N2O7P and a molecular weight of 360.30 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[methoxymethyl-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[methoxymethyl-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156635379 |
| Molecular Formula | C14H21N2O7P |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | propan-2-yl (2S)-2-[[methoxymethyl-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | COCP(=O)(N[C@@H](C)C(=O)OC(C)C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H21N2O7P/c1-10(2)22-14(17)11(3)15-24(20,9-21-4)23-13-7-5-12(6-8-13)16(18)19/h5-8,10-11H,9H2,1-4H3,(H,15,20)/t11-,24?/m0/s1 |
| InChIKey | PZGPBZWNLCNAQA-GNDHZGTQSA-N |
| XLogP | 2.70 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|