C19H29N2O8PS — CID 156688295
propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 156688295) has the molecular formula C19H29N2O8PS and a molecular weight of 476.49 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 156688295 |
| Molecular Formula | C19H29N2O8PS |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OCCSC(=O)C(C)(C)C)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H29N2O8PS/c1-13(2)28-17(22)14(3)20-30(26,27-11-12-31-18(23)19(4,5)6)29-16-9-7-15(8-10-16)21(24)25/h7-10,13-14H,11-12H2,1-6H3,(H,20,26)/t14-,30?/m0/s1 |
| InChIKey | SIXIHRKKMXHRFN-FHEMDEPNSA-N |
| XLogP | 4.33 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|