C16H23N2O7P — CID 163215141
propan-2-yl (2S)-2-[[cyclopropylmethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 163215141) has the molecular formula C16H23N2O7P and a molecular weight of 386.34 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[cyclopropylmethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[cyclopropylmethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163215141 |
| Molecular Formula | C16H23N2O7P |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | propan-2-yl (2S)-2-[[cyclopropylmethoxy-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OCC1CC1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H23N2O7P/c1-11(2)24-16(19)12(3)17-26(22,23-10-13-4-5-13)25-15-8-6-14(7-9-15)18(20)21/h6-9,11-13H,4-5,10H2,1-3H3,(H,17,22)/t12-,26?/m0/s1 |
| InChIKey | LHLJHHUJBIZZNC-ZPVYTRKOSA-N |
| XLogP | 3.44 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|