C20H25N2O6PS — CID 126525314
S-[2-[(benzylamino)-(4-nitrophenoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 126525314) has the molecular formula C20H25N2O6PS and a molecular weight of 452.47 g/mol. Its IUPAC name is S-[2-[(benzylamino)-(4-nitrophenoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(benzylamino)-(4-nitrophenoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 126525314 |
| Molecular Formula | C20H25N2O6PS |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | S-[2-[(benzylamino)-(4-nitrophenoxy)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(C)(C)C(=O)SCCOP(=O)(NCc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H25N2O6PS/c1-20(2,3)19(23)30-14-13-27-29(26,21-15-16-7-5-4-6-8-16)28-18-11-9-17(10-12-18)22(24)25/h4-12H,13-15H2,1-3H3,(H,21,26) |
| InChIKey | WCWNCIGGXSXRCE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|