C11H14ClN2O6P — CID 58664005
ethyl (2S)-2-[[chloro-(4-nitrophenoxy)phosphoryl]amino]propanoate (PubChem CID 58664005) has the molecular formula C11H14ClN2O6P and a molecular weight of 336.67 g/mol. Its IUPAC name is ethyl (2S)-2-[[chloro-(4-nitrophenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[chloro-(4-nitrophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 58664005 |
| Molecular Formula | C11H14ClN2O6P |
| Molecular Weight | 336.67 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | ethyl (2S)-2-[[chloro-(4-nitrophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(Cl)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H14ClN2O6P/c1-3-19-11(15)8(2)13-21(12,18)20-10-6-4-9(5-7-10)14(16)17/h4-8H,3H2,1-2H3,(H,13,18)/t8-,21?/m0/s1 |
| InChIKey | ZQKOQWUGSWHMAG-CBPHCGDMSA-N |
| XLogP | 2.86 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.67 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|