C15H23ClNO4P — CID 10405425
methyl (2S)-2-[[chloro-(4-pentylphenoxy)phosphoryl]amino]propanoate (PubChem CID 10405425) has the molecular formula C15H23ClNO4P and a molecular weight of 347.78 g/mol. Its IUPAC name is methyl (2S)-2-[[chloro-(4-pentylphenoxy)phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[chloro-(4-pentylphenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 10405425 |
| Molecular Formula | C15H23ClNO4P |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | methyl (2S)-2-[[chloro-(4-pentylphenoxy)phosphoryl]amino]propanoate |
| SMILES | CCCCCc1ccc(OP(=O)(Cl)N[C@@H](C)C(=O)OC)cc1 |
| InChI | InChI=1S/C15H23ClNO4P/c1-4-5-6-7-13-8-10-14(11-9-13)21-22(16,19)17-12(2)15(18)20-3/h8-12H,4-7H2,1-3H3,(H,17,19)/t12-,22?/m0/s1 |
| InChIKey | GDBSXYQZKMWJCS-BJDAYTSDSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|