C32H50N2O8P2 — CID 155575696
methyl (2S)-2-[[[3-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-propylphosphoryl]oxy-2-(3-methylphenyl)-5-pentylphenoxy]-propylphosphoryl]amino]propanoate (PubChem CID 155575696) has the molecular formula C32H50N2O8P2 and a molecular weight of 652.71 g/mol. Its IUPAC name is methyl (2S)-2-[[[3-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-propylphosphoryl]oxy-2-(3-methylphenyl)-5-pentylphenoxy]-propylphosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[3-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-propylphosphoryl]oxy-2-(3-methylphenyl)-5-pentylphenoxy]-propylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155575696 |
| Molecular Formula | C32H50N2O8P2 |
| Molecular Weight | 652.71 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | methyl (2S)-2-[[[3-[[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]-propylphosphoryl]oxy-2-(3-methylphenyl)-5-pentylphenoxy]-propylphosphoryl]amino]propanoate |
| SMILES | CCCCCc1cc(OP(=O)(CCC)N[C@@H](C)C(=O)OC)c(-c2cccc(C)c2)c(OP(=O)(CCC)N[C@@H](C)C(=O)OC)c1 |
| InChI | InChI=1S/C32H50N2O8P2/c1-9-12-13-16-26-21-28(41-43(37,18-10-2)33-24(5)31(35)39-7)30(27-17-14-15-23(4)20-27)29(22-26)42-44(38,19-11-3)34-25(6)32(36)40-8/h14-15,17,20-22,24-25H,9-13,16,18-19H2,1-8H3,(H,33,37)(H,34,38)/t24-,25-,43?,44?/m0/s1 |
| InChIKey | RINOQXUGFGYUGV-PWXLPKTKSA-N |
| XLogP | 7.66 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.71 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|