C22H30O3 — CID 155461207
3-(2-methoxypropan-2-yloxy)-2-(3-methylphenyl)-5-pentylphenol (PubChem CID 155461207) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 3-(2-methoxypropan-2-yloxy)-2-(3-methylphenyl)-5-pentylphenol.
| Compound Name | 3-(2-methoxypropan-2-yloxy)-2-(3-methylphenyl)-5-pentylphenol |
|---|---|
| PubChem CID | 155461207 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 3-(2-methoxypropan-2-yloxy)-2-(3-methylphenyl)-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(OC(C)(C)OC)c1 |
| InChI | InChI=1S/C22H30O3/c1-6-7-8-11-17-14-19(23)21(18-12-9-10-16(2)13-18)20(15-17)25-22(3,4)24-5/h9-10,12-15,23H,6-8,11H2,1-5H3 |
| InChIKey | IFASEPNZQDSZHH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|