C26H40O4P2 — CID 155575868
methyl-[2-(3-methylphenyl)-3-[methyl(propoxy)phosphanyl]oxy-5-pentylphenoxy]-propoxyphosphane (PubChem CID 155575868) has the molecular formula C26H40O4P2 and a molecular weight of 478.55 g/mol. Its IUPAC name is methyl-[2-(3-methylphenyl)-3-[methyl(propoxy)phosphanyl]oxy-5-pentylphenoxy]-propoxyphosphane.
| Compound Name | methyl-[2-(3-methylphenyl)-3-[methyl(propoxy)phosphanyl]oxy-5-pentylphenoxy]-propoxyphosphane |
|---|---|
| PubChem CID | 155575868 |
| Molecular Formula | C26H40O4P2 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | methyl-[2-(3-methylphenyl)-3-[methyl(propoxy)phosphanyl]oxy-5-pentylphenoxy]-propoxyphosphane |
| SMILES | CCCCCc1cc(OP(C)OCCC)c(-c2cccc(C)c2)c(OP(C)OCCC)c1 |
| InChI | InChI=1S/C26H40O4P2/c1-7-10-11-14-22-19-24(29-31(5)27-16-8-2)26(23-15-12-13-21(4)18-23)25(20-22)30-32(6)28-17-9-3/h12-13,15,18-20H,7-11,14,16-17H2,1-6H3 |
| InChIKey | GGTMKKASGRFCOW-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|