C24H30O8 — CID 155461348
[3-(ethoxycarbonyloxymethoxy)-2-(3-methylphenyl)-5-propylphenoxy]methyl ethyl carbonate (PubChem CID 155461348) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is [3-(ethoxycarbonyloxymethoxy)-2-(3-methylphenyl)-5-propylphenoxy]methyl ethyl carbonate.
| Compound Name | [3-(ethoxycarbonyloxymethoxy)-2-(3-methylphenyl)-5-propylphenoxy]methyl ethyl carbonate |
|---|---|
| PubChem CID | 155461348 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [3-(ethoxycarbonyloxymethoxy)-2-(3-methylphenyl)-5-propylphenoxy]methyl ethyl carbonate |
| SMILES | CCCc1cc(OCOC(=O)OCC)c(-c2cccc(C)c2)c(OCOC(=O)OCC)c1 |
| InChI | InChI=1S/C24H30O8/c1-5-9-18-13-20(29-15-31-23(25)27-6-2)22(19-11-8-10-17(4)12-19)21(14-18)30-16-32-24(26)28-7-3/h8,10-14H,5-7,9,15-16H2,1-4H3 |
| InChIKey | JQDGPGQLGBIHOK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|