C28H42O4 — CID 155461306
1,3-bis(ethoxymethoxy)-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)benzene (PubChem CID 155461306) has the molecular formula C28H42O4 and a molecular weight of 442.64 g/mol. Its IUPAC name is 1,3-bis(ethoxymethoxy)-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)benzene.
| Compound Name | 1,3-bis(ethoxymethoxy)-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)benzene |
|---|---|
| PubChem CID | 155461306 |
| Molecular Formula | C28H42O4 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 1,3-bis(ethoxymethoxy)-5-(2-methyloctan-2-yl)-2-(3-methylphenyl)benzene |
| SMILES | CCCCCCC(C)(C)c1cc(OCOCC)c(-c2cccc(C)c2)c(OCOCC)c1 |
| InChI | InChI=1S/C28H42O4/c1-7-10-11-12-16-28(5,6)24-18-25(31-20-29-8-2)27(23-15-13-14-22(4)17-23)26(19-24)32-21-30-9-3/h13-15,17-19H,7-12,16,20-21H2,1-6H3 |
| InChIKey | LKNHKEXIXKHXKS-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|