C27H36O3 — CID 155461252
1-(ethoxymethoxy)-9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromene (PubChem CID 155461252) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 1-(ethoxymethoxy)-9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromene.
| Compound Name | 1-(ethoxymethoxy)-9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromene |
|---|---|
| PubChem CID | 155461252 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 1-(ethoxymethoxy)-9-methyl-6-methylidene-3-(2-methyloctan-2-yl)benzo[c]chromene |
| SMILES | C=C1Oc2cc(C(C)(C)CCCCCC)cc(OCOCC)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C27H36O3/c1-7-9-10-11-14-27(5,6)21-16-24(29-18-28-8-2)26-23-15-19(3)12-13-22(23)20(4)30-25(26)17-21/h12-13,15-17H,4,7-11,14,18H2,1-3,5-6H3 |
| InChIKey | PDRVJGKAGLETLW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|