C25H33O6P — CID 155575548
dimethyl 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl phosphate (PubChem CID 155575548) has the molecular formula C25H33O6P and a molecular weight of 460.51 g/mol. Its IUPAC name is dimethyl 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl phosphate.
| Compound Name | dimethyl 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl phosphate |
|---|---|
| PubChem CID | 155575548 |
| Molecular Formula | C25H33O6P |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | dimethyl 2-(9-methyl-6-methylidene-3-pentylbenzo[c]chromen-1-yl)oxypropan-2-yl phosphate |
| SMILES | C=C1Oc2cc(CCCCC)cc(OC(C)(C)OP(=O)(OC)OC)c2-c2cc(C)ccc21 |
| InChI | InChI=1S/C25H33O6P/c1-8-9-10-11-19-15-22-24(21-14-17(2)12-13-20(21)18(3)29-22)23(16-19)30-25(4,5)31-32(26,27-6)28-7/h12-16H,3,8-11H2,1-2,4-7H3 |
| InChIKey | SREUMFIPMBKQEF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|