C25H36O6P2 — CID 164848716
1,3-bis[[methoxy(methyl)phosphoryl]oxy]-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene (PubChem CID 164848716) has the molecular formula C25H36O6P2 and a molecular weight of 494.51 g/mol. Its IUPAC name is 1,3-bis[[methoxy(methyl)phosphoryl]oxy]-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene.
| Compound Name | 1,3-bis[[methoxy(methyl)phosphoryl]oxy]-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene |
|---|---|
| PubChem CID | 164848716 |
| Molecular Formula | C25H36O6P2 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 1,3-bis[[methoxy(methyl)phosphoryl]oxy]-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(OP(C)(=O)OC)cc(CCCCC)cc1OP(C)(=O)OC |
| InChI | InChI=1S/C25H36O6P2/c1-9-10-11-12-20-16-23(30-32(7,26)28-5)25(24(17-20)31-33(8,27)29-6)22-15-19(4)13-14-21(22)18(2)3/h13-17H,2,9-12H2,1,3-8H3 |
| InChIKey | GBQPPXVXFDKCCD-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|