C33H49NO8 — CID 155461217
2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl N-[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]methyl]-N-methylcarbamate (PubChem CID 155461217) has the molecular formula C33H49NO8 and a molecular weight of 587.75 g/mol. Its IUPAC name is 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl N-[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]methyl]-N-methylcarbamate.
| Compound Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl N-[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 155461217 |
| Molecular Formula | C33H49NO8 |
| Molecular Weight | 587.75 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl N-[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]methyl]-N-methylcarbamate |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)cc1OCN(C)C(=O)OCCOCCOCCOCCOC |
| InChI | InChI=1S/C33H49NO8/c1-7-8-9-10-27-22-30(35)32(29-21-26(4)11-12-28(29)25(2)3)31(23-27)42-24-34(5)33(36)41-20-19-40-18-17-39-16-15-38-14-13-37-6/h11-12,21-23,35H,2,7-10,13-20,24H2,1,3-6H3 |
| InChIKey | MWRSUVITGQSXDN-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|