C27H38NO5P — CID 155575838
ethyl (2S)-2-[[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]-methylphosphoryl]amino]propanoate (PubChem CID 155575838) has the molecular formula C27H38NO5P and a molecular weight of 487.58 g/mol. Its IUPAC name is ethyl (2S)-2-[[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]-methylphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]-methylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 155575838 |
| Molecular Formula | C27H38NO5P |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | ethyl (2S)-2-[[[3-hydroxy-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylphenoxy]-methylphosphoryl]amino]propanoate |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)cc1OP(C)(=O)N[C@@H](C)C(=O)OCC |
| InChI | InChI=1S/C27H38NO5P/c1-8-10-11-12-21-16-24(29)26(23-15-19(5)13-14-22(23)18(3)4)25(17-21)33-34(7,31)28-20(6)27(30)32-9-2/h13-17,20,29H,3,8-12H2,1-2,4-7H3,(H,28,31)/t20-,34?/m0/s1 |
| InChIKey | CBXNIFSWJAHXDX-FGKHMDTNSA-N |
| XLogP | 6.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|