C26H35NO4 — CID 156715952
methyl N-[[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]methyl]-N-ethylcarbamate (PubChem CID 156715952) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is methyl N-[[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]methyl]-N-ethylcarbamate.
| Compound Name | methyl N-[[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]methyl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 156715952 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | methyl N-[[2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylphenyl]methyl]-N-ethylcarbamate |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(CN(CC)C(=O)OC)c1O |
| InChI | InChI=1S/C26H35NO4/c1-7-9-10-11-19-15-23(28)24(21-14-18(5)12-13-20(21)17(3)4)25(29)22(19)16-27(8-2)26(30)31-6/h12-15,28-29H,3,7-11,16H2,1-2,4-6H3 |
| InChIKey | CMMYMNGLNKLOPO-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|