C23H27F3O5S — CID 155576152
2,2,2-trifluoroethyl 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate (PubChem CID 155576152) has the molecular formula C23H27F3O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate.
| Compound Name | 2,2,2-trifluoroethyl 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate |
|---|---|
| PubChem CID | 155576152 |
| Molecular Formula | C23H27F3O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)OCC(F)(F)F)c1O |
| InChI | InChI=1S/C23H27F3O5S/c1-5-6-7-8-16-12-19(27)20(18-11-15(4)9-10-17(18)14(2)3)21(28)22(16)32(29,30)31-13-23(24,25)26/h9-12,27-28H,2,5-8,13H2,1,3-4H3 |
| InChIKey | LAFVRQIAFHLFBY-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|