C23H30O4S — CID 155576082
4-ethylsulfonyl-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene-1,3-diol (PubChem CID 155576082) has the molecular formula C23H30O4S and a molecular weight of 402.56 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-ethylsulfonyl-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155576082 |
| Molecular Formula | C23H30O4S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-ethylsulfonyl-2-(5-methyl-2-prop-1-en-2-ylphenyl)-5-pentylbenzene-1,3-diol |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)CC)c1O |
| InChI | InChI=1S/C23H30O4S/c1-6-8-9-10-17-14-20(24)21(22(25)23(17)28(26,27)7-2)19-13-16(5)11-12-18(19)15(3)4/h11-14,24-25H,3,6-10H2,1-2,4-5H3 |
| InChIKey | GQWRGKJMMMGCGH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|