C21H25NaO5S — CID 155576039
sodium 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate (PubChem CID 155576039) has the molecular formula C21H25NaO5S and a molecular weight of 412.48 g/mol. Its IUPAC name is sodium 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate.
| Compound Name | sodium 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate |
|---|---|
| PubChem CID | 155576039 |
| Molecular Formula | C21H25NaO5S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | sodium 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonate |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)[O-])c1O.[Na+] |
| InChI | InChI=1S/C21H26O5S.Na/c1-5-6-7-8-15-12-18(22)19(20(23)21(15)27(24,25)26)17-11-14(4)9-10-16(17)13(2)3;/h9-12,22-23H,2,5-8H2,1,3-4H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | XVROMFRDUZYZFW-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 97.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|