C21H26O5S — CID 155576040
2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonic acid (PubChem CID 155576040) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonic acid.
| Compound Name | 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonic acid |
|---|---|
| PubChem CID | 155576040 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2,4-dihydroxy-3-(5-methyl-2-prop-1-en-2-ylphenyl)-6-pentylbenzenesulfonic acid |
| SMILES | C=C(C)c1ccc(C)cc1-c1c(O)cc(CCCCC)c(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C21H26O5S/c1-5-6-7-8-15-12-18(22)19(20(23)21(15)27(24,25)26)17-11-14(4)9-10-16(17)13(2)3/h9-12,22-23H,2,5-8H2,1,3-4H3,(H,24,25,26) |
| InChIKey | NCPWZQXFEHWEKC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|