C20H25NO5S — CID 155576051
N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylacetamide (PubChem CID 155576051) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylacetamide.
| Compound Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylacetamide |
|---|---|
| PubChem CID | 155576051 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonylacetamide |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1S(=O)(=O)NC(C)=O |
| InChI | InChI=1S/C20H25NO5S/c1-4-5-6-9-16-12-17(23)18(15-10-7-8-13(2)11-15)19(24)20(16)27(25,26)21-14(3)22/h7-8,10-12,23-24H,4-6,9H2,1-3H3,(H,21,22) |
| InChIKey | DTQPHYYUOZTLTF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|