C26H37N3O5S — CID 155576188
N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-3-(4-methylpiperazin-1-yl)propanamide (PubChem CID 155576188) has the molecular formula C26H37N3O5S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-3-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-3-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 155576188 |
| Molecular Formula | C26H37N3O5S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-3-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1S(=O)(=O)NC(=O)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C26H37N3O5S/c1-4-5-6-9-21-18-22(30)24(20-10-7-8-19(2)17-20)25(32)26(21)35(33,34)27-23(31)11-12-29-15-13-28(3)14-16-29/h7-8,10,17-18,30,32H,4-6,9,11-16H2,1-3H3,(H,27,31) |
| InChIKey | NRJKIUXXJOHVPM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|