C23H28N4O5S — CID 155576089
N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide (PubChem CID 155576089) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide.
| Compound Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 155576089 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]sulfonyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)acetamide |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1S(=O)(=O)NC(=O)Cc1n[nH]c(C)n1 |
| InChI | InChI=1S/C23H28N4O5S/c1-4-5-6-9-17-12-18(28)21(16-10-7-8-14(2)11-16)22(30)23(17)33(31,32)27-20(29)13-19-24-15(3)25-26-19/h7-8,10-12,28,30H,4-6,9,13H2,1-3H3,(H,27,29)(H,24,25,26) |
| InChIKey | XYFMSNNSJVVMBJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|