C20H22N2O4 — CID 155575423
5-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 155575423) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 155575423 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 5-[2,4-dihydroxy-3-(3-methylphenyl)-6-pentylphenyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1-c1n[nH]c(=O)o1 |
| InChI | InChI=1S/C20H22N2O4/c1-3-4-5-8-14-11-15(23)16(13-9-6-7-12(2)10-13)18(24)17(14)19-21-22-20(25)26-19/h6-7,9-11,23-24H,3-5,8H2,1-2H3,(H,22,25) |
| InChIKey | GCZMDMSSHQGCRG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|