C22H23ClN2O4S — CID 155576169
4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3-methylphenyl)-5-pentylbenzene-1,3-diol (PubChem CID 155576169) has the molecular formula C22H23ClN2O4S and a molecular weight of 446.96 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3-methylphenyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3-methylphenyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 155576169 |
| Molecular Formula | C22H23ClN2O4S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3-methylphenyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(-c2cccc(C)c2)c(O)c1S(=O)(=O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C22H23ClN2O4S/c1-3-4-5-8-16-11-18(26)19(15-9-6-7-14(2)10-15)20(27)21(16)30(28,29)17-12-24-22(23)25-13-17/h6-7,9-13,26-27H,3-5,8H2,1-2H3 |
| InChIKey | ZPUGHWUBPHWZIF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|