C25H33ClN2O4S — CID 156744286
4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol (PubChem CID 156744286) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 156744286 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-(2-chloropyrimidin-5-yl)sulfonyl-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1S(=O)(=O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C25H33ClN2O4S/c1-5-6-7-11-19-14-22(29)21(13-12-18(4)10-8-9-17(2)3)23(30)24(19)33(31,32)20-15-27-25(26)28-16-20/h9,12,14-16,29-30H,5-8,10-11,13H2,1-4H3 |
| InChIKey | HDVXZNGHZKHXTA-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|