C26H40N2O4S — CID 156744278
4-(2,6-diazaspiro[3.3]heptan-2-ylsulfonyl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol (PubChem CID 156744278) has the molecular formula C26H40N2O4S and a molecular weight of 476.68 g/mol. Its IUPAC name is 4-(2,6-diazaspiro[3.3]heptan-2-ylsulfonyl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(2,6-diazaspiro[3.3]heptan-2-ylsulfonyl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 156744278 |
| Molecular Formula | C26H40N2O4S |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 4-(2,6-diazaspiro[3.3]heptan-2-ylsulfonyl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1S(=O)(=O)N1CC2(CNC2)C1 |
| InChI | InChI=1S/C26H40N2O4S/c1-5-6-7-11-21-14-23(29)22(13-12-20(4)10-8-9-19(2)3)24(30)25(21)33(31,32)28-17-26(18-28)15-27-16-26/h9,12,14,27,29-30H,5-8,10-11,13,15-18H2,1-4H3 |
| InChIKey | QHLJNWIWENWBTM-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|