C27H41NO2S — CID 156744330
4-(2-azaspiro[3.3]heptan-2-ylsulfanyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylbenzene-1,3-diol (PubChem CID 156744330) has the molecular formula C27H41NO2S and a molecular weight of 443.70 g/mol. Its IUPAC name is 4-(2-azaspiro[3.3]heptan-2-ylsulfanyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(2-azaspiro[3.3]heptan-2-ylsulfanyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 156744330 |
| Molecular Formula | C27H41NO2S |
| Molecular Weight | 443.70 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 4-(2-azaspiro[3.3]heptan-2-ylsulfanyl)-2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1SN1CC2(CCC2)C1 |
| InChI | InChI=1S/C27H41NO2S/c1-5-6-7-12-22-17-24(29)23(14-13-21(4)11-8-10-20(2)3)25(30)26(22)31-28-18-27(19-28)15-9-16-27/h10,13,17,29-30H,5-9,11-12,14-16,18-19H2,1-4H3/b21-13+ |
| InChIKey | OHYDOEKUCQYFIA-FYJGNVAPSA-N |
| XLogP | 7.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.70 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|