C25H37NO6S — CID 156744302
N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-3-oxobutanamide (PubChem CID 156744302) has the molecular formula C25H37NO6S and a molecular weight of 479.64 g/mol. Its IUPAC name is N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-3-oxobutanamide.
| Compound Name | N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-3-oxobutanamide |
|---|---|
| PubChem CID | 156744302 |
| Molecular Formula | C25H37NO6S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-3-oxobutanamide |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1S(=O)(=O)NC(=O)CC(C)=O |
| InChI | InChI=1S/C25H37NO6S/c1-6-7-8-12-20-16-22(28)21(14-13-18(4)11-9-10-17(2)3)24(30)25(20)33(31,32)26-23(29)15-19(5)27/h10,13,16,28,30H,6-9,11-12,14-15H2,1-5H3,(H,26,29) |
| InChIKey | NNHXXNBGHQCZRH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|