C34H48O8 — CID 167708761
2,4-dihydroxy-6-pentylbenzoic acid;3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid (PubChem CID 167708761) has the molecular formula C34H48O8 and a molecular weight of 584.75 g/mol. Its IUPAC name is 2,4-dihydroxy-6-pentylbenzoic acid;3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid.
| Compound Name | 2,4-dihydroxy-6-pentylbenzoic acid;3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 167708761 |
| Molecular Formula | C34H48O8 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | 2,4-dihydroxy-6-pentylbenzoic acid;3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1C(=O)O.CCCCCc1cc(O)cc(O)c1C(=O)O |
| InChI | InChI=1S/C22H32O4.C12H16O4/c1-5-6-7-11-17-14-19(23)18(21(24)20(17)22(25)26)13-12-16(4)10-8-9-15(2)3;1-2-3-4-5-8-6-9(13)7-10(14)11(8)12(15)16/h9,12,14,23-24H,5-8,10-11,13H2,1-4H3,(H,25,26);6-7,13-14H,2-5H2,1H3,(H,15,16)/b16-12+; |
| InChIKey | ZMTDTUAZIKIXHX-CLNHMMGSSA-N |
| XLogP | 8.29 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|