C29H38O4 — CID 146453765
3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-(6-phenylhexyl)benzoic acid (PubChem CID 146453765) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-(6-phenylhexyl)benzoic acid.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-(6-phenylhexyl)benzoic acid |
|---|---|
| PubChem CID | 146453765 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-(6-phenylhexyl)benzoic acid |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc(CCCCCCc2ccccc2)c(C(=O)O)c1O |
| InChI | InChI=1S/C29H38O4/c1-21(2)12-11-13-22(3)18-19-25-26(30)20-24(27(28(25)31)29(32)33)17-10-5-4-7-14-23-15-8-6-9-16-23/h6,8-9,12,15-16,18,20,30-31H,4-5,7,10-11,13-14,17,19H2,1-3H3,(H,32,33)/b22-18+ |
| InChIKey | HINYKWHGKFIIBJ-RELWKKBWSA-N |
| XLogP | 7.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|