C28H46O4Si — CID 140825982
4-[tert-butyl(dimethyl)silyl]oxy-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-6-pentylbenzoic acid (PubChem CID 140825982) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-6-pentylbenzoic acid.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 140825982 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-hydroxy-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O[Si](C)(C)C(C)(C)C)c(C/C=C(\C)CCC=C(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C28H46O4Si/c1-10-11-12-16-22-19-24(32-33(8,9)28(5,6)7)23(26(29)25(22)27(30)31)18-17-21(4)15-13-14-20(2)3/h14,17,19,29H,10-13,15-16,18H2,1-9H3,(H,30,31)/b21-17+ |
| InChIKey | GNMQNRROEICSJE-HEHNFIMWSA-N |
| XLogP | 8.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|