C22H34O4 — CID 166714650
2-hydroxy-3-[(Z)-3-methylhex-2-enyl]-6-pentyl-4-propan-2-yloxybenzoic acid (PubChem CID 166714650) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-hydroxy-3-[(Z)-3-methylhex-2-enyl]-6-pentyl-4-propan-2-yloxybenzoic acid.
| Compound Name | 2-hydroxy-3-[(Z)-3-methylhex-2-enyl]-6-pentyl-4-propan-2-yloxybenzoic acid |
|---|---|
| PubChem CID | 166714650 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-hydroxy-3-[(Z)-3-methylhex-2-enyl]-6-pentyl-4-propan-2-yloxybenzoic acid |
| SMILES | CCCCCc1cc(OC(C)C)c(C/C=C(/C)CCC)c(O)c1C(=O)O |
| InChI | InChI=1S/C22H34O4/c1-6-8-9-11-17-14-19(26-15(3)4)18(13-12-16(5)10-7-2)21(23)20(17)22(24)25/h12,14-15,23H,6-11,13H2,1-5H3,(H,24,25)/b16-12- |
| InChIKey | KSFVNGIISYNBTO-VBKFSLOCSA-N |
| XLogP | 5.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|