C23H34O4 — CID 167443282
2,4-dihydroxy-6-pentyl-3-(3,4,7-trimethylocta-2,6-dienyl)benzoic acid (PubChem CID 167443282) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 2,4-dihydroxy-6-pentyl-3-(3,4,7-trimethylocta-2,6-dienyl)benzoic acid.
| Compound Name | 2,4-dihydroxy-6-pentyl-3-(3,4,7-trimethylocta-2,6-dienyl)benzoic acid |
|---|---|
| PubChem CID | 167443282 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2,4-dihydroxy-6-pentyl-3-(3,4,7-trimethylocta-2,6-dienyl)benzoic acid |
| SMILES | CCCCCc1cc(O)c(CC=C(C)C(C)CC=C(C)C)c(O)c1C(=O)O |
| InChI | InChI=1S/C23H34O4/c1-6-7-8-9-18-14-20(24)19(22(25)21(18)23(26)27)13-12-17(5)16(4)11-10-15(2)3/h10,12,14,16,24-25H,6-9,11,13H2,1-5H3,(H,26,27) |
| InChIKey | AGMQHWXOQFLBEA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|