C17H23NaO4 — CID 71510863
sodium 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-pentylbenzoate (PubChem CID 71510863) has the molecular formula C17H23NaO4 and a molecular weight of 314.36 g/mol. Its IUPAC name is sodium 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-pentylbenzoate.
| Compound Name | sodium 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-pentylbenzoate |
|---|---|
| PubChem CID | 71510863 |
| Molecular Formula | C17H23NaO4 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | sodium 2,4-dihydroxy-3-(3-methylbut-2-enyl)-6-pentylbenzoate |
| SMILES | CCCCCc1cc(O)c(CC=C(C)C)c(O)c1C(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H24O4.Na/c1-4-5-6-7-12-10-14(18)13(9-8-11(2)3)16(19)15(12)17(20)21;/h8,10,18-19H,4-7,9H2,1-3H3,(H,20,21);/q;+1/p-1 |
| InChIKey | IVSMDMHAJXVDRW-UHFFFAOYSA-M |
| XLogP | -0.29 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|