C22H32CaO4+2 — CID 71508899
calcium 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid (PubChem CID 71508899) has the molecular formula C22H32CaO4+2 and a molecular weight of 400.57 g/mol. Its IUPAC name is calcium 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid.
| Compound Name | calcium 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid |
|---|---|
| PubChem CID | 71508899 |
| Molecular Formula | C22H32CaO4+2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | calcium 3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylbenzoic acid |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1C(=O)O.[Ca+2] |
| InChI | InChI=1S/C22H32O4.Ca/c1-5-6-7-11-17-14-19(23)18(21(24)20(17)22(25)26)13-12-16(4)10-8-9-15(2)3;/h9,12,14,23-24H,5-8,10-11,13H2,1-4H3,(H,25,26);/q;+2/b16-12+; |
| InChIKey | PDJKVYVBJXQEKR-CLNHMMGSSA-N |
| XLogP | 5.38 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|