C25H37NO5S — CID 156744317
4-[[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanylamino]-4-oxobutanoic acid (PubChem CID 156744317) has the molecular formula C25H37NO5S and a molecular weight of 463.64 g/mol. Its IUPAC name is 4-[[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 156744317 |
| Molecular Formula | C25H37NO5S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 4-[[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanylamino]-4-oxobutanoic acid |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1SNC(=O)CCC(=O)O |
| InChI | InChI=1S/C25H37NO5S/c1-5-6-7-11-19-16-21(27)20(13-12-18(4)10-8-9-17(2)3)24(31)25(19)32-26-22(28)14-15-23(29)30/h9,12,16,27,31H,5-8,10-11,13-15H2,1-4H3,(H,26,28)(H,29,30)/b18-12+ |
| InChIKey | OJVIASYQZIGLRT-LDADJPATSA-N |
| XLogP | 6.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|