C24H38N2O4S — CID 156744340
2-amino-N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanyl-3-hydroxypropanamide (PubChem CID 156744340) has the molecular formula C24H38N2O4S and a molecular weight of 450.65 g/mol. Its IUPAC name is 2-amino-N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanyl-3-hydroxypropanamide.
| Compound Name | 2-amino-N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanyl-3-hydroxypropanamide |
|---|---|
| PubChem CID | 156744340 |
| Molecular Formula | C24H38N2O4S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-amino-N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfanyl-3-hydroxypropanamide |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1SNC(=O)C(N)CO |
| InChI | InChI=1S/C24H38N2O4S/c1-5-6-7-11-18-14-21(28)19(13-12-17(4)10-8-9-16(2)3)22(29)23(18)31-26-24(30)20(25)15-27/h9,12,14,20,27-29H,5-8,10-11,13,15,25H2,1-4H3,(H,26,30)/b17-12+ |
| InChIKey | IYLWOQNLMIKZPO-SFQUDFHCSA-N |
| XLogP | 4.51 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|