C25H34O2S — CID 167430943
2-(3,7-dimethylocta-2,6-dienyl)-5-pentyl-4-thiophen-2-ylbenzene-1,3-diol (PubChem CID 167430943) has the molecular formula C25H34O2S and a molecular weight of 398.61 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-5-pentyl-4-thiophen-2-ylbenzene-1,3-diol.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-pentyl-4-thiophen-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167430943 |
| Molecular Formula | C25H34O2S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-5-pentyl-4-thiophen-2-ylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1-c1cccs1 |
| InChI | InChI=1S/C25H34O2S/c1-5-6-7-12-20-17-22(26)21(15-14-19(4)11-8-10-18(2)3)25(27)24(20)23-13-9-16-28-23/h9-10,13-14,16-17,26-27H,5-8,11-12,15H2,1-4H3 |
| InChIKey | SLHXHKGAUFQKKY-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|