C27H32O3 — CID 167430937
4-(1-benzofuran-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-propylbenzene-1,3-diol (PubChem CID 167430937) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-propylbenzene-1,3-diol.
| Compound Name | 4-(1-benzofuran-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-propylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167430937 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-propylbenzene-1,3-diol |
| SMILES | CCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C27H32O3/c1-5-9-21-16-23(28)22(15-14-19(4)11-8-10-18(2)3)27(29)26(21)25-17-20-12-6-7-13-24(20)30-25/h6-7,10,12-14,16-17,28-29H,5,8-9,11,15H2,1-4H3 |
| InChIKey | HWVRVSPPRMNOMC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|