C29H36O2S — CID 167430906
4-(1-benzothiophen-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol (PubChem CID 167430906) has the molecular formula C29H36O2S and a molecular weight of 448.67 g/mol. Its IUPAC name is 4-(1-benzothiophen-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-(1-benzothiophen-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167430906 |
| Molecular Formula | C29H36O2S |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-(1-benzothiophen-2-yl)-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1-c1cc2ccccc2s1 |
| InChI | InChI=1S/C29H36O2S/c1-5-6-7-14-23-18-25(30)24(17-16-21(4)12-10-11-20(2)3)29(31)28(23)27-19-22-13-8-9-15-26(22)32-27/h8-9,11,13,15-16,18-19,30-31H,5-7,10,12,14,17H2,1-4H3 |
| InChIKey | KNQJYXNRILQPIP-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|