C25H36N2O2 — CID 167430945
2-(3,7-dimethylocta-2,6-dienyl)-4-(2-methylpyrazol-3-yl)-5-pentylbenzene-1,3-diol (PubChem CID 167430945) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,6-dienyl)-4-(2-methylpyrazol-3-yl)-5-pentylbenzene-1,3-diol.
| Compound Name | 2-(3,7-dimethylocta-2,6-dienyl)-4-(2-methylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 167430945 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-(3,7-dimethylocta-2,6-dienyl)-4-(2-methylpyrazol-3-yl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1-c1ccnn1C |
| InChI | InChI=1S/C25H36N2O2/c1-6-7-8-12-20-17-23(28)21(14-13-19(4)11-9-10-18(2)3)25(29)24(20)22-15-16-26-27(22)5/h10,13,15-17,28-29H,6-9,11-12,14H2,1-5H3 |
| InChIKey | VLSLENQGLMRDIX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|