C25H41NO4S — CID 156744356
4-[2-(dimethylamino)ethylsulfonyl]-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol (PubChem CID 156744356) has the molecular formula C25H41NO4S and a molecular weight of 451.67 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylsulfonyl]-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol.
| Compound Name | 4-[2-(dimethylamino)ethylsulfonyl]-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 156744356 |
| Molecular Formula | C25H41NO4S |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.28 |
| IUPAC Name | 4-[2-(dimethylamino)ethylsulfonyl]-2-(3,7-dimethylocta-2,6-dienyl)-5-pentylbenzene-1,3-diol |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1S(=O)(=O)CCN(C)C |
| InChI | InChI=1S/C25H41NO4S/c1-7-8-9-13-21-18-23(27)22(15-14-20(4)12-10-11-19(2)3)24(28)25(21)31(29,30)17-16-26(5)6/h11,14,18,27-28H,7-10,12-13,15-17H2,1-6H3 |
| InChIKey | QUXVQEMPUKFEEL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|