C26H36N2O5S2 — CID 156744341
N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-2-(1,3-thiazol-2-yl)acetamide (PubChem CID 156744341) has the molecular formula C26H36N2O5S2 and a molecular weight of 520.72 g/mol. Its IUPAC name is N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-2-(1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-2-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 156744341 |
| Molecular Formula | C26H36N2O5S2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | N-[3-(3,7-dimethylocta-2,6-dienyl)-2,4-dihydroxy-6-pentylphenyl]sulfonyl-2-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCCc1cc(O)c(CC=C(C)CCC=C(C)C)c(O)c1S(=O)(=O)NC(=O)Cc1nccs1 |
| InChI | InChI=1S/C26H36N2O5S2/c1-5-6-7-11-20-16-22(29)21(13-12-19(4)10-8-9-18(2)3)25(31)26(20)35(32,33)28-23(30)17-24-27-14-15-34-24/h9,12,14-16,29,31H,5-8,10-11,13,17H2,1-4H3,(H,28,30) |
| InChIKey | WWFZPTAYFRLMND-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|