C25H37NO6S — CID 168737582
N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfonyloxetane-2-carboxamide (PubChem CID 168737582) has the molecular formula C25H37NO6S and a molecular weight of 479.64 g/mol. Its IUPAC name is N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfonyloxetane-2-carboxamide.
| Compound Name | N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfonyloxetane-2-carboxamide |
|---|---|
| PubChem CID | 168737582 |
| Molecular Formula | C25H37NO6S |
| Molecular Weight | 479.64 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | N-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,4-dihydroxy-6-pentylphenyl]sulfonyloxetane-2-carboxamide |
| SMILES | CCCCCc1cc(O)c(C/C=C(\C)CCC=C(C)C)c(O)c1S(=O)(=O)NC(=O)C1CCO1 |
| InChI | InChI=1S/C25H37NO6S/c1-5-6-7-11-19-16-21(27)20(13-12-18(4)10-8-9-17(2)3)23(28)24(19)33(30,31)26-25(29)22-14-15-32-22/h9,12,16,22,27-28H,5-8,10-11,13-15H2,1-4H3,(H,26,29)/b18-12+ |
| InChIKey | VNHHIBNBKMHMKY-LDADJPATSA-N |
| XLogP | 4.66 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|